C27H32O13 — CID 163068106
(2R)-2-[4-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one (PubChem CID 163068106) has the molecular formula C27H32O13 and a molecular weight of 564.54 g/mol. Its IUPAC name is (2R)-2-[4-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-2-[4-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163068106 |
| Molecular Formula | C27H32O13 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | (2R)-2-[4-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5,7-dimethoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(OC)c2c(c1)O[C@@H](c1ccc(O[C@@H]3OC[C@@H](O[C@H]4OC[C@H](O)[C@H](O)[C@H]4O)[C@H](O)[C@@H]3O)cc1)CC2=O |
| InChI | InChI=1S/C27H32O13/c1-34-14-7-18(35-2)21-15(28)9-17(39-19(21)8-14)12-3-5-13(6-4-12)38-26-25(33)23(31)20(11-37-26)40-27-24(32)22(30)16(29)10-36-27/h3-8,16-17,20,22-27,29-33H,9-11H2,1-2H3/t16-,17+,20+,22-,23-,24+,25-,26-,27+/m0/s1 |
| InChIKey | SVNWACIHAFUKAJ-UATUJUEYSA-N |
| XLogP | -0.31 |
| TPSA | 182.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |