C15H26 — CID 163068277
(4S)-4-methyl-1-[(E,2S)-6-methylhept-3-en-2-yl]cyclohexene (PubChem CID 163068277) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (4S)-4-methyl-1-[(E,2S)-6-methylhept-3-en-2-yl]cyclohexene.
| Compound Name | (4S)-4-methyl-1-[(E,2S)-6-methylhept-3-en-2-yl]cyclohexene |
|---|---|
| PubChem CID | 163068277 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (4S)-4-methyl-1-[(E,2S)-6-methylhept-3-en-2-yl]cyclohexene |
| SMILES | CC(C)C/C=C/[C@H](C)C1=CC[C@@H](C)CC1 |
| InChI | InChI=1S/C15H26/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h5,7,10,12-14H,6,8-9,11H2,1-4H3/b7-5+/t13-,14+/m1/s1 |
| InChIKey | AOTOEKFIRGUTMJ-UMGRQFOVSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|