C10H14Br2O — CID 163068308
4,6-dibromo-3,7-dimethylocta-2,7-dienal (PubChem CID 163068308) has the molecular formula C10H14Br2O and a molecular weight of 310.03 g/mol. Its IUPAC name is 4,6-dibromo-3,7-dimethylocta-2,7-dienal.
| Compound Name | 4,6-dibromo-3,7-dimethylocta-2,7-dienal |
|---|---|
| PubChem CID | 163068308 |
| Molecular Formula | C10H14Br2O |
| Molecular Weight | 310.03 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 4,6-dibromo-3,7-dimethylocta-2,7-dienal |
| SMILES | C=C(C)C(Br)CC(Br)C(C)=CC=O |
| InChI | InChI=1S/C10H14Br2O/c1-7(2)9(11)6-10(12)8(3)4-5-13/h4-5,9-10H,1,6H2,2-3H3 |
| InChIKey | ZFFLWDURCNGKGU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.03 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|