C32H45NO5 — CID 163068425
[(1R,2S,6S,9R,10S,11S,14R,15R,18R,20S,23R,24R)-10-hydroxy-6,10,23-trimethyl-17-oxo-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-20-yl] furan-2-carboxylate (PubChem CID 163068425) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is [(1R,2S,6S,9R,10S,11S,14R,15R,18R,20S,23R,24R)-10-hydroxy-6,10,23-trimethyl-17-oxo-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-20-yl] furan-2-carboxylate.
| Compound Name | [(1R,2S,6S,9R,10S,11S,14R,15R,18R,20S,23R,24R)-10-hydroxy-6,10,23-trimethyl-17-oxo-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-20-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 163068425 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | [(1R,2S,6S,9R,10S,11S,14R,15R,18R,20S,23R,24R)-10-hydroxy-6,10,23-trimethyl-17-oxo-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-20-yl] furan-2-carboxylate |
| SMILES | C[C@H]1CC[C@H]2N(C1)C[C@H]1[C@@H]3C[C@@H]4[C@H](CC(=O)[C@@H]5C[C@@H](OC(=O)c6ccco6)CC[C@]45C)[C@H]3CC[C@@H]1[C@]2(C)O |
| InChI | InChI=1S/C32H45NO5/c1-18-6-9-29-32(3,36)24-8-7-20-21(23(24)17-33(29)16-18)14-25-22(20)15-27(34)26-13-19(10-11-31(25,26)2)38-30(35)28-5-4-12-37-28/h4-5,12,18-26,29,36H,6-11,13-17H2,1-3H3/t18-,19-,20-,21+,22+,23-,24-,25+,26-,29+,31+,32-/m0/s1 |
| InChIKey | QDRWJGGEHHAYQU-JPRKBZMHSA-N |
| XLogP | 5.34 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |