C18H32O — CID 163068598
4-[(4aR,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]butan-1-ol (PubChem CID 163068598) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 4-[(4aR,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]butan-1-ol.
| Compound Name | 4-[(4aR,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 163068598 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 4-[(4aR,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]butan-1-ol |
| SMILES | CC1=C(CCCCO)[C@@]2(C)CCCC(C)(C)[C@H]2CC1 |
| InChI | InChI=1S/C18H32O/c1-14-9-10-16-17(2,3)11-7-12-18(16,4)15(14)8-5-6-13-19/h16,19H,5-13H2,1-4H3/t16-,18-/m1/s1 |
| InChIKey | FNSKSLNGIWWXGL-SJLPKXTDSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|