C33H50N2O2 — CID 163068853
N-[(1S,3S,5R,6R,8R,11S,12S,15S,16R)-5-hydroxy-7,7,12,16-tetramethyl-15-[(1S)-1-(methylamino)ethyl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-N-methylbenzamide (PubChem CID 163068853) has the molecular formula C33H50N2O2 and a molecular weight of 506.78 g/mol. Its IUPAC name is N-[(1S,3S,5R,6R,8R,11S,12S,15S,16R)-5-hydroxy-7,7,12,16-tetramethyl-15-[(1S)-1-(methylamino)ethyl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-N-methylbenzamide.
| Compound Name | N-[(1S,3S,5R,6R,8R,11S,12S,15S,16R)-5-hydroxy-7,7,12,16-tetramethyl-15-[(1S)-1-(methylamino)ethyl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 163068853 |
| Molecular Formula | C33H50N2O2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | N-[(1S,3S,5R,6R,8R,11S,12S,15S,16R)-5-hydroxy-7,7,12,16-tetramethyl-15-[(1S)-1-(methylamino)ethyl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-N-methylbenzamide |
| SMILES | CN[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](N(C)C(=O)c5ccccc5)[C@H](O)C[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C33H50N2O2/c1-21(34-6)23-15-16-31(5)26-14-13-25-29(2,3)27(35(7)28(37)22-11-9-8-10-12-22)24(36)19-33(25)20-32(26,33)18-17-30(23,31)4/h8-12,21,23-27,34,36H,13-20H2,1-7H3/t21-,23+,24+,25-,26-,27-,30+,31-,32-,33+/m0/s1 |
| InChIKey | DWELWHXSAQDFLO-NPUYFIEYSA-N |
| XLogP | 6.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |