C21H36O3 — CID 163068949
[(4aR,5S,6R,8aR)-5-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol (PubChem CID 163068949) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is [(4aR,5S,6R,8aR)-5-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol.
| Compound Name | [(4aR,5S,6R,8aR)-5-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 163068949 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | [(4aR,5S,6R,8aR)-5-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-5,6,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
| SMILES | CO[C@@H]1C[C@H](CC[C@@]2(C)[C@H](C)CC[C@@]3(C)C(CO)=CCC[C@H]23)CO1 |
| InChI | InChI=1S/C21H36O3/c1-15-8-10-21(3)17(13-22)6-5-7-18(21)20(15,2)11-9-16-12-19(23-4)24-14-16/h6,15-16,18-19,22H,5,7-14H2,1-4H3/t15-,16+,18-,19+,20+,21+/m1/s1 |
| InChIKey | QJWMWEZKMZTCAP-JWPBWTMGSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|