About 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one
7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one (PubChem CID 163069913) has the molecular formula C10H9ClO4
and a molecular weight of 228.63 g/mol. Its IUPAC name is 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one.
Molecular Properties
| Compound Name | 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| PubChem CID | 163069913 |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| SMILES | CC1OC(=O)c2c(ccc(Cl)c2O)C1O |
| InChI | InChI=1S/C10H9ClO4/c1-4-8(12)5-2-3-6(11)9(13)7(5)10(14)15-4/h2-4,8,12-13H,1H3 |
| InChIKey | FHGHJJYPQAOONX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one?
The IUPAC name of 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one (CID 163069913) is 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one.
What is the SMILES notation for 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one?
The canonical SMILES for 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one is CC1OC(=O)c2c(ccc(Cl)c2O)C1O.
What is the InChIKey of 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one?
The InChIKey is FHGHJJYPQAOONX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO4/c1-4-8(12)5-2-3-6(11)9(13)7(5)10(14)15-4/h2-4,8,12-13H,1H3.
What are the key properties of 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one?
7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one has a molecular weight of 228.63 g/mol, XLogP of 1.64, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one is sourced from PubChem (CID 163069913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).