C14H12O5 — CID 163070367
7,9,10a-trihydroxy-3-methyl-1H-benzo[g]isochromen-10-one (PubChem CID 163070367) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 7,9,10a-trihydroxy-3-methyl-1H-benzo[g]isochromen-10-one.
| Compound Name | 7,9,10a-trihydroxy-3-methyl-1H-benzo[g]isochromen-10-one |
|---|---|
| PubChem CID | 163070367 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 7,9,10a-trihydroxy-3-methyl-1H-benzo[g]isochromen-10-one |
| SMILES | CC1=CC2=Cc3cc(O)cc(O)c3C(=O)C2(O)CO1 |
| InChI | InChI=1S/C14H12O5/c1-7-2-9-3-8-4-10(15)5-11(16)12(8)13(17)14(9,18)6-19-7/h2-5,15-16,18H,6H2,1H3 |
| InChIKey | XOVRKSIVJVEJQA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |