About [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate
[3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate (PubChem CID 163070434) has the molecular formula C22H24N2O5
and a molecular weight of 396.44 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate.
Molecular Properties
| Compound Name | [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate |
| PubChem CID | 163070434 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate |
| SMILES | COc1ccc(-c2coc3cc(OC(=O)C(N)CCCCN)ccc3c2=O)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-27-15-7-5-14(6-8-15)18-13-28-20-12-16(9-10-17(20)21(18)25)29-22(26)19(24)4-2-3-11-23/h5-10,12-13,19H,2-4,11,23-24H2,1H3 |
| InChIKey | WSXZMNZWXLNIPA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate?
The IUPAC name of [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate (CID 163070434) is [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate.
What is the SMILES notation for [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate?
The canonical SMILES for [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate is COc1ccc(-c2coc3cc(OC(=O)C(N)CCCCN)ccc3c2=O)cc1.
What is the InChIKey of [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate?
The InChIKey is WSXZMNZWXLNIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O5/c1-27-15-7-5-14(6-8-15)18-13-28-20-12-16(9-10-17(20)21(18)25)29-22(26)19(24)4-2-3-11-23/h5-10,12-13,19H,2-4,11,23-24H2,1H3.
What are the key properties of [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate?
[3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate has a molecular weight of 396.44 g/mol, XLogP of 2.83, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 2,6-diaminohexanoate is sourced from PubChem (CID 163070434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).