C20H40O3 — CID 163071073
(E,7R,11S,12S,14R)-3,7,11,15-tetramethylhexadec-2-ene-1,12,14-triol (PubChem CID 163071073) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is (E,7R,11S,12S,14R)-3,7,11,15-tetramethylhexadec-2-ene-1,12,14-triol.
| Compound Name | (E,7R,11S,12S,14R)-3,7,11,15-tetramethylhexadec-2-ene-1,12,14-triol |
|---|---|
| PubChem CID | 163071073 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | (E,7R,11S,12S,14R)-3,7,11,15-tetramethylhexadec-2-ene-1,12,14-triol |
| SMILES | C/C(=C\CO)CCC[C@H](C)CCC[C@H](C)[C@@H](O)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C20H40O3/c1-15(2)19(22)14-20(23)18(5)11-7-10-16(3)8-6-9-17(4)12-13-21/h12,15-16,18-23H,6-11,13-14H2,1-5H3/b17-12+/t16-,18-,19+,20-/m0/s1 |
| InChIKey | JMZZBVNSDNHLIV-BZKFBUQNSA-N |
| XLogP | 4.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|