C23H36O3 — CID 163071705
(1'R,4R,4'R,9'R,10'S,13'S)-2,2,5',5',9'-pentamethylspiro[1,3-dioxolane-4,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-6'-one (PubChem CID 163071705) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1'R,4R,4'R,9'R,10'S,13'S)-2,2,5',5',9'-pentamethylspiro[1,3-dioxolane-4,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-6'-one.
| Compound Name | (1'R,4R,4'R,9'R,10'S,13'S)-2,2,5',5',9'-pentamethylspiro[1,3-dioxolane-4,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-6'-one |
|---|---|
| PubChem CID | 163071705 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1'R,4R,4'R,9'R,10'S,13'S)-2,2,5',5',9'-pentamethylspiro[1,3-dioxolane-4,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-6'-one |
| SMILES | CC1(C)OC[C@]2(C[C@]34CC[C@H]5C(C)(C)C(=O)CC[C@]5(C)[C@H]3CC[C@H]2C4)O1 |
| InChI | InChI=1S/C23H36O3/c1-19(2)16-8-11-22-12-15(23(13-22)14-25-20(3,4)26-23)6-7-17(22)21(16,5)10-9-18(19)24/h15-17H,6-14H2,1-5H3/t15-,16-,17+,21-,22+,23-/m0/s1 |
| InChIKey | CUMXMFWUFRFNQK-OWNZSMNJSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |