C32H42N2O5 — CID 163071731
(2S)-2-[[2-[[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylpropanoic acid (PubChem CID 163071731) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is (2S)-2-[[2-[[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163071731 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (2S)-2-[[2-[[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)[C@@H]1CC[C@@H]2[C@H]3CCC4=CC(=NOCC(=O)N[C@@H](Cc5ccccc5)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C32H42N2O5/c1-20(35)25-11-12-26-24-10-9-22-18-23(13-15-31(22,2)27(24)14-16-32(25,26)3)34-39-19-29(36)33-28(30(37)38)17-21-7-5-4-6-8-21/h4-8,18,24-28H,9-17,19H2,1-3H3,(H,33,36)(H,37,38)/t24-,25+,26-,27+,28+,31+,32-/m1/s1 |
| InChIKey | CYWWELYHCZFKIG-VPVMGOGWSA-N |
| XLogP | 5.34 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|