C24H30O9 — CID 163072218
[6-acetyloxy-8,8a-dihydroxy-1,4-dimethyl-3-oxo-7-(3-oxopent-1-en-2-yl)-5,6,7,8-tetrahydroazulen-5-yl] 2,3-dimethyloxirane-2-carboxylate (PubChem CID 163072218) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [6-acetyloxy-8,8a-dihydroxy-1,4-dimethyl-3-oxo-7-(3-oxopent-1-en-2-yl)-5,6,7,8-tetrahydroazulen-5-yl] 2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [6-acetyloxy-8,8a-dihydroxy-1,4-dimethyl-3-oxo-7-(3-oxopent-1-en-2-yl)-5,6,7,8-tetrahydroazulen-5-yl] 2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 163072218 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [6-acetyloxy-8,8a-dihydroxy-1,4-dimethyl-3-oxo-7-(3-oxopent-1-en-2-yl)-5,6,7,8-tetrahydroazulen-5-yl] 2,3-dimethyloxirane-2-carboxylate |
| SMILES | C=C(C(=O)CC)C1C(OC(C)=O)C(OC(=O)C2(C)OC2C)C(C)=C2C(=O)C=C(C)C2(O)C1O |
| InChI | InChI=1S/C24H30O9/c1-8-15(26)11(3)17-20(31-14(6)25)19(32-22(29)23(7)13(5)33-23)12(4)18-16(27)9-10(2)24(18,30)21(17)28/h9,13,17,19-21,28,30H,3,8H2,1-2,4-7H3 |
| InChIKey | SYOJGYGAGDJBET-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|