C23H34O4 — CID 163072345
3-oxo-3-[[(1S,2R,6R,7S,10R,13S)-2,6,12-trimethyl-6-tetracyclo[11.2.1.01,10.02,7]hexadec-11-enyl]methoxy]propanoic acid (PubChem CID 163072345) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 3-oxo-3-[[(1S,2R,6R,7S,10R,13S)-2,6,12-trimethyl-6-tetracyclo[11.2.1.01,10.02,7]hexadec-11-enyl]methoxy]propanoic acid.
| Compound Name | 3-oxo-3-[[(1S,2R,6R,7S,10R,13S)-2,6,12-trimethyl-6-tetracyclo[11.2.1.01,10.02,7]hexadec-11-enyl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 163072345 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 3-oxo-3-[[(1S,2R,6R,7S,10R,13S)-2,6,12-trimethyl-6-tetracyclo[11.2.1.01,10.02,7]hexadec-11-enyl]methoxy]propanoic acid |
| SMILES | CC1=C[C@H]2CC[C@@H]3[C@](C)(COC(=O)CC(=O)O)CCC[C@@]3(C)[C@]23CC[C@H]1C3 |
| InChI | InChI=1S/C23H34O4/c1-15-11-17-5-6-18-21(2,14-27-20(26)12-19(24)25)8-4-9-22(18,3)23(17)10-7-16(15)13-23/h11,16-18H,4-10,12-14H2,1-3H3,(H,24,25)/t16-,17+,18+,21-,22+,23-/m0/s1 |
| InChIKey | ISUWFQVXZCXIRR-DSDHECLKSA-N |
| XLogP | 4.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|