About 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol
2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol (PubChem CID 163072721) has the molecular formula C21H35NO
and a molecular weight of 317.52 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol |
| PubChem CID | 163072721 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol |
| SMILES | CC=CC=CC=CCCC1CC(O)C(CC2CCCCC2)N1C |
| InChI | InChI=1S/C21H35NO/c1-3-4-5-6-7-8-12-15-19-17-21(23)20(22(19)2)16-18-13-10-9-11-14-18/h3-8,18-21,23H,9-17H2,1-2H3 |
| InChIKey | KQFSVLBLEAJLHF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol?
The IUPAC name of 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol (CID 163072721) is 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol.
What is the SMILES notation for 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol?
The canonical SMILES for 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol is CC=CC=CC=CCCC1CC(O)C(CC2CCCCC2)N1C.
What is the InChIKey of 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol?
The InChIKey is KQFSVLBLEAJLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO/c1-3-4-5-6-7-8-12-15-19-17-21(23)20(22(19)2)16-18-13-10-9-11-14-18/h3-8,18-21,23H,9-17H2,1-2H3.
What are the key properties of 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol?
2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol has a molecular weight of 317.52 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethyl)-1-methyl-5-nona-3,5,7-trienylpyrrolidin-3-ol is sourced from PubChem (CID 163072721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).