C21H35NO — CID 163072722
(3S,5R)-2-(cyclohexylmethyl)-1-methyl-5-[(3E,5E,7E)-nona-3,5,7-trienyl]pyrrolidin-3-ol (PubChem CID 163072722) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (3S,5R)-2-(cyclohexylmethyl)-1-methyl-5-[(3E,5E,7E)-nona-3,5,7-trienyl]pyrrolidin-3-ol.
| Compound Name | (3S,5R)-2-(cyclohexylmethyl)-1-methyl-5-[(3E,5E,7E)-nona-3,5,7-trienyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 163072722 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (3S,5R)-2-(cyclohexylmethyl)-1-methyl-5-[(3E,5E,7E)-nona-3,5,7-trienyl]pyrrolidin-3-ol |
| SMILES | C/C=C/C=C/C=C/CC[C@@H]1C[C@H](O)C(CC2CCCCC2)N1C |
| InChI | InChI=1S/C21H35NO/c1-3-4-5-6-7-8-12-15-19-17-21(23)20(22(19)2)16-18-13-10-9-11-14-18/h3-8,18-21,23H,9-17H2,1-2H3/b4-3+,6-5+,8-7+/t19-,20?,21+/m1/s1 |
| InChIKey | KQFSVLBLEAJLHF-ZQLWBCEFSA-N |
| XLogP | 4.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|