C26H44O5 — CID 163072754
2-methyl-6-[2-(4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl)propan-2-yloxy]oxane-3,4,5-triol (PubChem CID 163072754) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 2-methyl-6-[2-(4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl)propan-2-yloxy]oxane-3,4,5-triol.
| Compound Name | 2-methyl-6-[2-(4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl)propan-2-yloxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163072754 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 2-methyl-6-[2-(4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl)propan-2-yloxy]oxane-3,4,5-triol |
| SMILES | CC1=CCCC(C)=CCC(C(C)(C)OC2OC(C)C(O)C(O)C2O)CCC(C)=CCC1 |
| InChI | InChI=1S/C26H44O5/c1-17-9-7-11-18(2)13-15-21(16-14-19(3)12-8-10-17)26(5,6)31-25-24(29)23(28)22(27)20(4)30-25/h9,12-13,20-25,27-29H,7-8,10-11,14-16H2,1-6H3 |
| InChIKey | YRMNOGCLIIGQEI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|