C12H22O4 — CID 163072772
(4R,5S,12S)-4,5-dihydroxy-12-methyl-oxacyclododecan-2-one (PubChem CID 163072772) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (4R,5S,12S)-4,5-dihydroxy-12-methyl-oxacyclododecan-2-one.
| Compound Name | (4R,5S,12S)-4,5-dihydroxy-12-methyl-oxacyclododecan-2-one |
|---|---|
| PubChem CID | 163072772 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (4R,5S,12S)-4,5-dihydroxy-12-methyl-oxacyclododecan-2-one |
| SMILES | C[C@H]1CCCCCC[C@H](O)[C@H](O)CC(=O)O1 |
| InChI | InChI=1S/C12H22O4/c1-9-6-4-2-3-5-7-10(13)11(14)8-12(15)16-9/h9-11,13-14H,2-8H2,1H3/t9-,10-,11+/m0/s1 |
| InChIKey | CTRDXWHAKGQMPY-GARJFASQSA-N |
| XLogP | 1.38 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |