C19H32O5 — CID 163073103
[(4S,5R,6S,8S)-4,6,8-trimethyl-3,7-dioxodecan-5-yl] (2S)-2-methyl-3-oxopentanoate (PubChem CID 163073103) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(4S,5R,6S,8S)-4,6,8-trimethyl-3,7-dioxodecan-5-yl] (2S)-2-methyl-3-oxopentanoate.
| Compound Name | [(4S,5R,6S,8S)-4,6,8-trimethyl-3,7-dioxodecan-5-yl] (2S)-2-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 163073103 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(4S,5R,6S,8S)-4,6,8-trimethyl-3,7-dioxodecan-5-yl] (2S)-2-methyl-3-oxopentanoate |
| SMILES | CCC(=O)[C@H](C)C(=O)O[C@H]([C@H](C)C(=O)CC)[C@H](C)C(=O)[C@@H](C)CC |
| InChI | InChI=1S/C19H32O5/c1-8-11(4)17(22)14(7)18(12(5)15(20)9-2)24-19(23)13(6)16(21)10-3/h11-14,18H,8-10H2,1-7H3/t11-,12+,13-,14+,18+/m0/s1 |
| InChIKey | YVNLIKGLYXFWBE-ZZRRNANISA-N |
| XLogP | 3.38 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|