C18H18N4O2S — CID 163073480
N-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]pyridine-3-carboxamide (PubChem CID 163073480) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]pyridine-3-carboxamide.
| Compound Name | N-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163073480 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=S)N1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2)c1cccnc1 |
| InChI | InChI=1S/C18H18N4O2S/c23-16-5-1-4-15-14-7-12(10-22(15)16)9-21(11-14)18(25)20-17(24)13-3-2-6-19-8-13/h1-6,8,12,14H,7,9-11H2,(H,20,24,25)/t12-,14-/m1/s1 |
| InChIKey | GQHUSONDURUMQW-TZMCWYRMSA-N |
| XLogP | 1.38 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|