C15H18O10 — CID 163073802
6-(3,4-dimethoxybenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163073802) has the molecular formula C15H18O10 and a molecular weight of 358.30 g/mol. Its IUPAC name is 6-(3,4-dimethoxybenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(3,4-dimethoxybenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163073802 |
| Molecular Formula | C15H18O10 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-(3,4-dimethoxybenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)OC2OC(C(=O)O)C(O)C(O)C2O)cc1OC |
| InChI | InChI=1S/C15H18O10/c1-22-7-4-3-6(5-8(7)23-2)14(21)25-15-11(18)9(16)10(17)12(24-15)13(19)20/h3-5,9-12,15-18H,1-2H3,(H,19,20) |
| InChIKey | QQHYYHJSWRVMAM-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |