C23H25NO5 — CID 163074020
2,3,7,8,11-pentamethoxy-5-methyl-6H-benzo[c]phenanthridine (PubChem CID 163074020) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2,3,7,8,11-pentamethoxy-5-methyl-6H-benzo[c]phenanthridine.
| Compound Name | 2,3,7,8,11-pentamethoxy-5-methyl-6H-benzo[c]phenanthridine |
|---|---|
| PubChem CID | 163074020 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2,3,7,8,11-pentamethoxy-5-methyl-6H-benzo[c]phenanthridine |
| SMILES | COc1cc2cc(OC)c3c(c2cc1OC)N(C)Cc1c-3ccc(OC)c1OC |
| InChI | InChI=1S/C23H25NO5/c1-24-12-16-14(7-8-17(25-2)23(16)29-6)21-20(28-5)10-13-9-18(26-3)19(27-4)11-15(13)22(21)24/h7-11H,12H2,1-6H3 |
| InChIKey | DWULEZLJOYLXKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |