C17H22NO2P — CID 163075158
(2R,4S,5R)-3,4-dimethyl-2-(5-methylhexa-1,3,4-trien-3-yl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 163075158) has the molecular formula C17H22NO2P and a molecular weight of 303.34 g/mol. Its IUPAC name is (2R,4S,5R)-3,4-dimethyl-2-(5-methylhexa-1,3,4-trien-3-yl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2R,4S,5R)-3,4-dimethyl-2-(5-methylhexa-1,3,4-trien-3-yl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 163075158 |
| Molecular Formula | C17H22NO2P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2R,4S,5R)-3,4-dimethyl-2-(5-methylhexa-1,3,4-trien-3-yl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C=CC(=C=C(C)C)[P@@]1(=O)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C17H22NO2P/c1-6-16(12-13(2)3)21(19)18(5)14(4)17(20-21)15-10-8-7-9-11-15/h6-11,14,17H,1H2,2-5H3/t14-,17-,21+/m0/s1 |
| InChIKey | YWOMHXTZWJXYGH-XXHMAFKTSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|