C16H24O2 — CID 163075279
(3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol (PubChem CID 163075279) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol.
| Compound Name | (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol |
|---|---|
| PubChem CID | 163075279 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3S,3aS,5aR,6R,9aS,9bS)-3,5a,9-trimethyl-2-methylidene-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-6-ol |
| SMILES | C=C1O[C@H]2[C@@H](CC[C@@]3(C)[C@H](O)CC=C(C)[C@H]23)[C@@H]1C |
| InChI | InChI=1S/C16H24O2/c1-9-5-6-13(17)16(4)8-7-12-10(2)11(3)18-15(12)14(9)16/h5,10,12-15,17H,3,6-8H2,1-2,4H3/t10-,12+,13-,14-,15+,16+/m1/s1 |
| InChIKey | STIYXYABWPDGCS-PRLTYNAASA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|