C21H30N2O4 — CID 163075630
2-[5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propylacetamide (PubChem CID 163075630) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propylacetamide.
| Compound Name | 2-[5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 163075630 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-[5-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CC1CC2OC(CNC3Cc4ccccc4C3)C(O)C2O1 |
| InChI | InChI=1S/C21H30N2O4/c1-2-7-22-19(24)11-16-10-17-21(26-16)20(25)18(27-17)12-23-15-8-13-5-3-4-6-14(13)9-15/h3-6,15-18,20-21,23,25H,2,7-12H2,1H3,(H,22,24) |
| InChIKey | MAFJTZXTPXJDPE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |