C33H50N2O8 — CID 163075769
[(1R,3R,7S)-3-acetyloxy-7-hydroxy-1-[4-[(4-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]octyl] (4aR,8aR)-2-oxo-1,3,4,4a,5,6,7,8-octahydroquinoline-8a-carboxylate (PubChem CID 163075769) has the molecular formula C33H50N2O8 and a molecular weight of 602.77 g/mol. Its IUPAC name is [(1R,3R,7S)-3-acetyloxy-7-hydroxy-1-[4-[(4-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]octyl] (4aR,8aR)-2-oxo-1,3,4,4a,5,6,7,8-octahydroquinoline-8a-carboxylate.
| Compound Name | [(1R,3R,7S)-3-acetyloxy-7-hydroxy-1-[4-[(4-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]octyl] (4aR,8aR)-2-oxo-1,3,4,4a,5,6,7,8-octahydroquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 163075769 |
| Molecular Formula | C33H50N2O8 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | [(1R,3R,7S)-3-acetyloxy-7-hydroxy-1-[4-[(4-hydroxy-3-methoxyphenyl)methyl]piperidin-4-yl]octyl] (4aR,8aR)-2-oxo-1,3,4,4a,5,6,7,8-octahydroquinoline-8a-carboxylate |
| SMILES | COc1cc(CC2([C@@H](C[C@@H](CCC[C@H](C)O)OC(C)=O)OC(=O)[C@@]34CCCC[C@@H]3CCC(=O)N4)CCNCC2)ccc1O |
| InChI | InChI=1S/C33H50N2O8/c1-22(36)7-6-9-26(42-23(2)37)20-29(43-31(40)33-14-5-4-8-25(33)11-13-30(39)35-33)32(15-17-34-18-16-32)21-24-10-12-27(38)28(19-24)41-3/h10,12,19,22,25-26,29,34,36,38H,4-9,11,13-18,20-21H2,1-3H3,(H,35,39)/t22-,25+,26+,29+,33+/m0/s1 |
| InChIKey | CHEGCFALHCLXJF-CAGGANBQSA-N |
| XLogP | 3.94 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |