C31H33NO7 — CID 163076102
(3S,4S)-4-(3-cyclopentyloxy-4-hydroxy-5-methoxyphenyl)-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol (PubChem CID 163076102) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is (3S,4S)-4-(3-cyclopentyloxy-4-hydroxy-5-methoxyphenyl)-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol.
| Compound Name | (3S,4S)-4-(3-cyclopentyloxy-4-hydroxy-5-methoxyphenyl)-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol |
|---|---|
| PubChem CID | 163076102 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (3S,4S)-4-(3-cyclopentyloxy-4-hydroxy-5-methoxyphenyl)-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol |
| SMILES | COc1cc([C@H]2COc3cc4c5c(c3[C@H]2O)CCc2c(OC)cc(O)c(c2-5)CN4)cc(OC2CCCC2)c1O |
| InChI | InChI=1S/C31H33NO7/c1-36-23-12-22(33)19-13-32-21-11-24-29(18-8-7-17(23)27(19)28(18)21)30(34)20(14-38-24)15-9-25(37-2)31(35)26(10-15)39-16-5-3-4-6-16/h9-12,16,20,30,32-35H,3-8,13-14H2,1-2H3/t20-,30+/m1/s1 |
| InChIKey | MMYQWBZEDIQIHV-KEEVHDRGSA-N |
| XLogP | 5.34 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|