C29H24N2 — CID 163076513
1-phenyl-N-[(2R)-2-phenyl-5-(2-phenylethenyl)-2,3-dihydro-1H-indol-6-yl]methanimine (PubChem CID 163076513) has the molecular formula C29H24N2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-phenyl-N-[(2R)-2-phenyl-5-(2-phenylethenyl)-2,3-dihydro-1H-indol-6-yl]methanimine.
| Compound Name | 1-phenyl-N-[(2R)-2-phenyl-5-(2-phenylethenyl)-2,3-dihydro-1H-indol-6-yl]methanimine |
|---|---|
| PubChem CID | 163076513 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-phenyl-N-[(2R)-2-phenyl-5-(2-phenylethenyl)-2,3-dihydro-1H-indol-6-yl]methanimine |
| SMILES | C(=Cc1cc2c(cc1/N=C/c1ccccc1)N[C@@H](c1ccccc1)C2)c1ccccc1 |
| InChI | InChI=1S/C29H24N2/c1-4-10-22(11-5-1)16-17-25-18-26-19-28(24-14-8-3-9-15-24)31-29(26)20-27(25)30-21-23-12-6-2-7-13-23/h1-18,20-21,28,31H,19H2/b17-16?,30-21+/t28-/m1/s1 |
| InChIKey | NNHUHSLDRWWVTG-CRZYQNARSA-N |
| XLogP | 7.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|