C19H26O4 — CID 163076601
(7-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-8a-yl) 2-methylprop-2-enoate (PubChem CID 163076601) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (7-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-8a-yl) 2-methylprop-2-enoate.
| Compound Name | (7-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-8a-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163076601 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (7-hydroxy-3,4a,5-trimethyl-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-8a-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12Cc3occ(C)c3CC1(C)C(C)CC(O)C2 |
| InChI | InChI=1S/C19H26O4/c1-11(2)17(21)23-19-7-14(20)6-13(4)18(19,5)8-15-12(3)10-22-16(15)9-19/h10,13-14,20H,1,6-9H2,2-5H3 |
| InChIKey | LGEOMYMJLRNTAP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|