C57H105O23P — CID 163077270
[2-heptadec-7-enoyloxy-3-[hydroxy-[3,4,5-trihydroxy-2,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]cyclohexyl]oxyphosphoryl]oxypropyl] 10-methyloctadecanoate (PubChem CID 163077270) has the molecular formula C57H105O23P and a molecular weight of 1189.42 g/mol. Its IUPAC name is [2-heptadec-7-enoyloxy-3-[hydroxy-[3,4,5-trihydroxy-2,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]cyclohexyl]oxyphosphoryl]oxypropyl] 10-methyloctadecanoate.
| Compound Name | [2-heptadec-7-enoyloxy-3-[hydroxy-[3,4,5-trihydroxy-2,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]cyclohexyl]oxyphosphoryl]oxypropyl] 10-methyloctadecanoate |
|---|---|
| PubChem CID | 163077270 |
| Molecular Formula | C57H105O23P |
| Molecular Weight | 1189.42 g/mol |
| Exact Mass | 1188.68 |
| IUPAC Name | [2-heptadec-7-enoyloxy-3-[hydroxy-[3,4,5-trihydroxy-2,6-bis[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]cyclohexyl]oxyphosphoryl]oxypropyl] 10-methyloctadecanoate |
| SMILES | CCCCCCCCCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CCCCCCCC)COP(=O)(O)OC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C57H105O23P/c1-4-6-8-10-12-13-14-15-16-17-18-19-25-29-33-43(61)75-39(36-73-42(60)32-28-24-21-20-23-27-31-38(3)30-26-22-11-9-7-5-2)37-74-81(71,72)80-55-53(78-56-51(69)46(64)44(62)40(34-58)76-56)49(67)48(66)50(68)54(55)79-57-52(70)47(65)45(63)41(35-59)77-57/h16-17,38-41,44-59,62-70H,4-15,18-37H2,1-3H3,(H,71,72) |
| InChIKey | NLMBYYVVRRQDHL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 367.81 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1189.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|