C19H20N2O2 — CID 163077952
12-ethenyl-3-hydroxy-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-9-one (PubChem CID 163077952) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 12-ethenyl-3-hydroxy-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-9-one.
| Compound Name | 12-ethenyl-3-hydroxy-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-9-one |
|---|---|
| PubChem CID | 163077952 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 12-ethenyl-3-hydroxy-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2(7),3,5,13-tetraen-9-one |
| SMILES | C=CC12C=CCN3CCC4(c5c(O)cccc5NC(=O)C4C1)C32 |
| InChI | InChI=1S/C19H20N2O2/c1-2-18-7-4-9-21-10-8-19(17(18)21)12(11-18)16(23)20-13-5-3-6-14(22)15(13)19/h2-7,12,17,22H,1,8-11H2,(H,20,23) |
| InChIKey | RWTCMSKUTIPTOD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|