C16H28O6 — CID 163078448
dimethyl (2R,3S)-2-[(2R)-2,6-dimethylhept-5-enyl]-2,3-dihydroxy-3-methylbutanedioate (PubChem CID 163078448) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-[(2R)-2,6-dimethylhept-5-enyl]-2,3-dihydroxy-3-methylbutanedioate.
| Compound Name | dimethyl (2R,3S)-2-[(2R)-2,6-dimethylhept-5-enyl]-2,3-dihydroxy-3-methylbutanedioate |
|---|---|
| PubChem CID | 163078448 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | dimethyl (2R,3S)-2-[(2R)-2,6-dimethylhept-5-enyl]-2,3-dihydroxy-3-methylbutanedioate |
| SMILES | COC(=O)[C@@](C)(O)[C@](O)(C[C@H](C)CCC=C(C)C)C(=O)OC |
| InChI | InChI=1S/C16H28O6/c1-11(2)8-7-9-12(3)10-16(20,14(18)22-6)15(4,19)13(17)21-5/h8,12,19-20H,7,9-10H2,1-6H3/t12-,15-,16+/m1/s1 |
| InChIKey | GZWXFHHEDXDUGY-WQVCFCJDSA-N |
| XLogP | 1.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|