C15H26O2 — CID 163078869
2-[(1R,3S,4R)-4-ethenyl-4-(hydroxymethyl)-3-prop-1-en-2-ylcyclohexyl]propan-2-ol (PubChem CID 163078869) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(1R,3S,4R)-4-ethenyl-4-(hydroxymethyl)-3-prop-1-en-2-ylcyclohexyl]propan-2-ol.
| Compound Name | 2-[(1R,3S,4R)-4-ethenyl-4-(hydroxymethyl)-3-prop-1-en-2-ylcyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 163078869 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(1R,3S,4R)-4-ethenyl-4-(hydroxymethyl)-3-prop-1-en-2-ylcyclohexyl]propan-2-ol |
| SMILES | C=C[C@]1(CO)CC[C@@H](C(C)(C)O)C[C@H]1C(=C)C |
| InChI | InChI=1S/C15H26O2/c1-6-15(10-16)8-7-12(14(4,5)17)9-13(15)11(2)3/h6,12-13,16-17H,1-2,7-10H2,3-5H3/t12-,13+,15-/m1/s1 |
| InChIKey | USJQEHIEUGYOFY-VNHYZAJKSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|