C25H32O8 — CID 163079196
[(1S,4aS,6S,7S,7aS)-6,7-dihydroxy-4-(hydroxymethyl)-7-[(E)-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] (3S)-3-methylpentanoate (PubChem CID 163079196) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is [(1S,4aS,6S,7S,7aS)-6,7-dihydroxy-4-(hydroxymethyl)-7-[(E)-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] (3S)-3-methylpentanoate.
| Compound Name | [(1S,4aS,6S,7S,7aS)-6,7-dihydroxy-4-(hydroxymethyl)-7-[(E)-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] (3S)-3-methylpentanoate |
|---|---|
| PubChem CID | 163079196 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(1S,4aS,6S,7S,7aS)-6,7-dihydroxy-4-(hydroxymethyl)-7-[(E)-4-(4-hydroxyphenyl)-2-oxobut-3-enyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] (3S)-3-methylpentanoate |
| SMILES | CC[C@H](C)CC(=O)O[C@@H]1OC=C(CO)[C@H]2C[C@H](O)[C@](O)(CC(=O)/C=C/c3ccc(O)cc3)[C@@H]12 |
| InChI | InChI=1S/C25H32O8/c1-3-15(2)10-22(30)33-24-23-20(17(13-26)14-32-24)11-21(29)25(23,31)12-19(28)9-6-16-4-7-18(27)8-5-16/h4-9,14-15,20-21,23-24,26-27,29,31H,3,10-13H2,1-2H3/b9-6+/t15-,20+,21-,23+,24-,25+/m0/s1 |
| InChIKey | DOXMOACLBJXJMH-IGODNRIBSA-N |
| XLogP | 2.30 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|