About 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol
4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol (PubChem CID 163079248) has the molecular formula C17H34O4
and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol |
| PubChem CID | 163079248 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol |
| SMILES | C=CCCCCCCCCC(O)CC(CO)CC(O)CO |
| InChI | InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-16(20)11-15(13-18)12-17(21)14-19/h2,15-21H,1,3-14H2 |
| InChIKey | LRAFKVQWVKKBJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol?
The IUPAC name of 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol (CID 163079248) is 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol.
What is the SMILES notation for 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol?
The canonical SMILES for 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol is C=CCCCCCCCCC(O)CC(CO)CC(O)CO.
What is the InChIKey of 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol?
The InChIKey is LRAFKVQWVKKBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-16(20)11-15(13-18)12-17(21)14-19/h2,15-21H,1,3-14H2.
What are the key properties of 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol?
4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol has a molecular weight of 302.46 g/mol, XLogP of 2.40, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)hexadec-15-ene-1,2,6-triol is sourced from PubChem (CID 163079248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).