C33H41NO8 — CID 163079282
(2S,3S,4R)-3-[(3S,4S)-4-hydroxy-8-[(3-hydroxyphenyl)methyl]-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-6-methoxy-2-(3-methoxypropyl)-7-(methylaminomethyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 163079282) has the molecular formula C33H41NO8 and a molecular weight of 579.69 g/mol. Its IUPAC name is (2S,3S,4R)-3-[(3S,4S)-4-hydroxy-8-[(3-hydroxyphenyl)methyl]-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-6-methoxy-2-(3-methoxypropyl)-7-(methylaminomethyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (2S,3S,4R)-3-[(3S,4S)-4-hydroxy-8-[(3-hydroxyphenyl)methyl]-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-6-methoxy-2-(3-methoxypropyl)-7-(methylaminomethyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 163079282 |
| Molecular Formula | C33H41NO8 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (2S,3S,4R)-3-[(3S,4S)-4-hydroxy-8-[(3-hydroxyphenyl)methyl]-6-methoxy-3,4-dihydro-2H-chromen-3-yl]-6-methoxy-2-(3-methoxypropyl)-7-(methylaminomethyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CNCc1cc2c(cc1OC)[C@H](O)[C@H]([C@H]1COc3c(Cc4cccc(O)c4)cc(OC)cc3[C@H]1O)[C@H](CCCOC)O2 |
| InChI | InChI=1S/C33H41NO8/c1-34-17-21-14-29-24(16-28(21)40-4)32(37)30(27(42-29)9-6-10-38-2)26-18-41-33-20(11-19-7-5-8-22(35)12-19)13-23(39-3)15-25(33)31(26)36/h5,7-8,12-16,26-27,30-32,34-37H,6,9-11,17-18H2,1-4H3/t26-,27+,30-,31-,32+/m1/s1 |
| InChIKey | JDMHDKMHIKSPOG-VUUBULTESA-N |
| XLogP | 4.30 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|