C33H41NO4 — CID 163081306
(1S,3S,4S,5S,8R,10S,14R)-5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 163081306) has the molecular formula C33H41NO4 and a molecular weight of 515.69 g/mol. Its IUPAC name is (1S,3S,4S,5S,8R,10S,14R)-5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1S,3S,4S,5S,8R,10S,14R)-5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 163081306 |
| Molecular Formula | C33H41NO4 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | (1S,3S,4S,5S,8R,10S,14R)-5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | C[C@@H]1CCC[C@@]2(C)C[C@H]3OC(=O)[C@H](CN4CCC(C(O)(c5ccccc5)c5ccccc5)CC4)[C@@H]3[C@@H]3O[C@]132 |
| InChI | InChI=1S/C33H41NO4/c1-22-10-9-17-31(2)20-27-28(29-33(22,31)38-29)26(30(35)37-27)21-34-18-15-25(16-19-34)32(36,23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-8,11-14,22,25-29,36H,9-10,15-21H2,1-2H3/t22-,26-,27-,28+,29+,31+,33-/m1/s1 |
| InChIKey | KEAJPYUYLCEFRT-JXOLVHCRSA-N |
| XLogP | 5.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|