C36H62O6 — CID 163082534
2-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163082534) has the molecular formula C36H62O6 and a molecular weight of 590.89 g/mol. Its IUPAC name is 2-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163082534 |
| Molecular Formula | C36H62O6 |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | 2-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(CCC(C)C1CCC2C3CC=C4CC(OCC5OC(CO)C(O)C(O)C5O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C36H62O6/c1-7-23(21(2)3)9-8-22(4)27-12-13-28-26-11-10-24-18-25(14-16-35(24,5)29(26)15-17-36(27,28)6)41-20-31-33(39)34(40)32(38)30(19-37)42-31/h10,21-23,25-34,37-40H,7-9,11-20H2,1-6H3 |
| InChIKey | AIOFDKVXQRUPBC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|