C38H66O2 — CID 163083051
[(2E,6E)-3,7-dimethyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] (Z)-octadec-9-enoate (PubChem CID 163083051) has the molecular formula C38H66O2 and a molecular weight of 554.94 g/mol. Its IUPAC name is [(2E,6E)-3,7-dimethyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] (Z)-octadec-9-enoate.
| Compound Name | [(2E,6E)-3,7-dimethyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 163083051 |
| Molecular Formula | C38H66O2 |
| Molecular Weight | 554.94 g/mol |
| Exact Mass | 554.51 |
| IUPAC Name | [(2E,6E)-3,7-dimethyl-9-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC/C=C(\C)CC/C=C(\C)CC[C@@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C38H66O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27-37(39)40-32-30-34(3)25-22-24-33(2)28-29-36-35(4)26-23-31-38(36,5)6/h14-15,24,26,30,36H,7-13,16-23,25,27-29,31-32H2,1-6H3/b15-14-,33-24+,34-30+/t36-/m1/s1 |
| InChIKey | ZRSCNXSUFGOPHE-NEHZPRIOSA-N |
| XLogP | 12.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.94 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|