C26H42O — CID 163083230
(1E,5Z,9E,12R,13S)-13-methoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene (PubChem CID 163083230) has the molecular formula C26H42O and a molecular weight of 370.62 g/mol. Its IUPAC name is (1E,5Z,9E,12R,13S)-13-methoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene.
| Compound Name | (1E,5Z,9E,12R,13S)-13-methoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene |
|---|---|
| PubChem CID | 163083230 |
| Molecular Formula | C26H42O |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | (1E,5Z,9E,12R,13S)-13-methoxy-1,5,9-trimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene |
| SMILES | C=C(CCC=C(C)C)[C@H]1C/C=C(\C)CC/C=C(/C)CC/C=C(\C)C[C@@H]1OC |
| InChI | InChI=1S/C26H42O/c1-20(2)11-8-16-24(6)25-18-17-22(4)14-9-12-21(3)13-10-15-23(5)19-26(25)27-7/h11-12,15,17,25-26H,6,8-10,13-14,16,18-19H2,1-5,7H3/b21-12-,22-17+,23-15+/t25-,26+/m1/s1 |
| InChIKey | FGDIMNAMJBFDNJ-RTYMIUGPSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|