C28H42O8 — CID 163083336
[(1R,3S,5R,6aR,7R,8R,9S,10S,10aR)-1-acetyloxy-10-ethoxy-3,5-dihydroxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate (PubChem CID 163083336) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is [(1R,3S,5R,6aR,7R,8R,9S,10S,10aR)-1-acetyloxy-10-ethoxy-3,5-dihydroxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate.
| Compound Name | [(1R,3S,5R,6aR,7R,8R,9S,10S,10aR)-1-acetyloxy-10-ethoxy-3,5-dihydroxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate |
|---|---|
| PubChem CID | 163083336 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [(1R,3S,5R,6aR,7R,8R,9S,10S,10aR)-1-acetyloxy-10-ethoxy-3,5-dihydroxy-7,8-dimethyl-7-[(2Z)-3-methylpenta-2,4-dienyl]-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate |
| SMILES | C=C/C(C)=C\C[C@]1(C)[C@H]2C[C@@H](O)C=C3[C@@H](O)O[C@H](OC(C)=O)[C@@]32[C@H](OCC)[C@@H](OC(=O)CCC)[C@@H]1C |
| InChI | InChI=1S/C28H42O8/c1-8-11-22(31)35-23-17(5)27(7,13-12-16(4)9-2)21-15-19(30)14-20-25(32)36-26(34-18(6)29)28(20,21)24(23)33-10-3/h9,12,14,17,19,21,23-26,30,32H,2,8,10-11,13,15H2,1,3-7H3/b16-12-/t17-,19-,21+,23-,24+,25-,26-,27-,28-/m0/s1 |
| InChIKey | ICYRBQHWTHLAOZ-FIPISJMFSA-N |
| XLogP | 3.81 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|