C26H37N3O5 — CID 163083460
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 163083460) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163083460 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCN(CC1CCCN2CCCCC12)C(=O)C1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C26H37N3O5/c1-32-12-11-28(17-19-5-4-10-27-9-3-2-6-22(19)27)26(31)20-15-25(30)29(18-20)21-7-8-23-24(16-21)34-14-13-33-23/h7-8,16,19-20,22H,2-6,9-15,17-18H2,1H3 |
| InChIKey | GAPGMZFVKJTQGF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |