C17H22N2O10S2 — CID 163083717
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-(5-methoxy-1H-indol-3-yl)-N-sulfooxyethanimidothioate (PubChem CID 163083717) has the molecular formula C17H22N2O10S2 and a molecular weight of 478.50 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-(5-methoxy-1H-indol-3-yl)-N-sulfooxyethanimidothioate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-(5-methoxy-1H-indol-3-yl)-N-sulfooxyethanimidothioate |
|---|---|
| PubChem CID | 163083717 |
| Molecular Formula | C17H22N2O10S2 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-(5-methoxy-1H-indol-3-yl)-N-sulfooxyethanimidothioate |
| SMILES | COc1ccc2[nH]cc(CC(=NOS(=O)(=O)O)SC3OC(CO)C(O)C(O)C3O)c2c1 |
| InChI | InChI=1S/C17H22N2O10S2/c1-27-9-2-3-11-10(5-9)8(6-18-11)4-13(19-29-31(24,25)26)30-17-16(23)15(22)14(21)12(7-20)28-17/h2-3,5-6,12,14-18,20-23H,4,7H2,1H3,(H,24,25,26) |
| InChIKey | VGSOGNUJYYDTSG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 191.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|