C35H44O8 — CID 163083979
(2S,3R,6S)-2-[2,4-dihydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 163083979) has the molecular formula C35H44O8 and a molecular weight of 592.73 g/mol. Its IUPAC name is (2S,3R,6S)-2-[2,4-dihydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2S,3R,6S)-2-[2,4-dihydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 163083979 |
| Molecular Formula | C35H44O8 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | (2S,3R,6S)-2-[2,4-dihydroxy-3-methoxy-5-(3-methylbutoxy)phenyl]-11-methoxy-6-(3-methylbutyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | COc1cc2c(c3c1-c1ccc(O)cc1[C@@H](CCC(C)C)C3)C[C@@H](O)[C@H](c1cc(OCCC(C)C)c(O)c(OC)c1O)O2 |
| InChI | InChI=1S/C35H44O8/c1-18(2)7-8-20-13-25-24-15-27(37)34(26-16-30(42-12-11-19(3)4)33(39)35(41-6)32(26)38)43-28(24)17-29(40-5)31(25)22-10-9-21(36)14-23(20)22/h9-10,14,16-20,27,34,36-39H,7-8,11-13,15H2,1-6H3/t20-,27+,34-/m0/s1 |
| InChIKey | DIENHDIERONKDD-VPZWEVNMSA-N |
| XLogP | 7.03 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |