C37H68O5 — CID 163084884
[(2S)-3-hydroxy-2-tetradec-9-enoyloxypropyl] icos-11-enoate (PubChem CID 163084884) has the molecular formula C37H68O5 and a molecular weight of 592.95 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-tetradec-9-enoyloxypropyl] icos-11-enoate.
| Compound Name | [(2S)-3-hydroxy-2-tetradec-9-enoyloxypropyl] icos-11-enoate |
|---|---|
| PubChem CID | 163084884 |
| Molecular Formula | C37H68O5 |
| Molecular Weight | 592.95 g/mol |
| Exact Mass | 592.51 |
| IUPAC Name | [(2S)-3-hydroxy-2-tetradec-9-enoyloxypropyl] icos-11-enoate |
| SMILES | CCCCC=CCCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C37H68O5/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-23-25-27-29-31-36(39)41-34-35(33-38)42-37(40)32-30-28-26-24-21-14-12-10-8-6-4-2/h10,12,16-17,35,38H,3-9,11,13-15,18-34H2,1-2H3/t35-/m0/s1 |
| InChIKey | PYGQHYCIWAIGTQ-DHUJRADRSA-N |
| XLogP | 10.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.95 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|