C32H50O2 — CID 163084970
(3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) acetate (PubChem CID 163084970) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is (3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) acetate.
| Compound Name | (3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) acetate |
|---|---|
| PubChem CID | 163084970 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | (3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl) acetate |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CC=C4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C32H50O2/c1-20(2)22-12-15-29(6)18-19-31(8)23(27(22)29)10-11-25-30(7)16-14-26(34-21(3)33)28(4,5)24(30)13-17-32(25,31)9/h11,22-24,26-27H,1,10,12-19H2,2-9H3 |
| InChIKey | PEVJTJPKXXBEEK-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|