C28H40O11 — CID 163085118
[6-acetyloxy-3,3a,4-trihydroxy-3,6,9-trimethyl-8-(2-methylbut-2-enoyloxy)-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] hexanoate (PubChem CID 163085118) has the molecular formula C28H40O11 and a molecular weight of 552.62 g/mol. Its IUPAC name is [6-acetyloxy-3,3a,4-trihydroxy-3,6,9-trimethyl-8-(2-methylbut-2-enoyloxy)-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] hexanoate.
| Compound Name | [6-acetyloxy-3,3a,4-trihydroxy-3,6,9-trimethyl-8-(2-methylbut-2-enoyloxy)-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] hexanoate |
|---|---|
| PubChem CID | 163085118 |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [6-acetyloxy-3,3a,4-trihydroxy-3,6,9-trimethyl-8-(2-methylbut-2-enoyloxy)-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] hexanoate |
| SMILES | CC=C(C)C(=O)OC1C(C)=C2C(C1OC(=O)CCCCC)C(C)(OC(C)=O)CC(O)C1(O)C2OC(=O)C1(C)O |
| InChI | InChI=1S/C28H40O11/c1-8-10-11-12-18(31)36-22-20-19(15(4)21(22)37-24(32)14(3)9-2)23-28(35,27(7,34)25(33)38-23)17(30)13-26(20,6)39-16(5)29/h9,17,20-23,30,34-35H,8,10-13H2,1-7H3 |
| InChIKey | GSOCHXRXWXQMKF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|