C19H24O7 — CID 163085906
[(7S,9S,10Z,11aR)-7-acetyloxy-3-(hydroxymethyl)-10-methyl-6-methylidene-2-oxo-4,5,7,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate (PubChem CID 163085906) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is [(7S,9S,10Z,11aR)-7-acetyloxy-3-(hydroxymethyl)-10-methyl-6-methylidene-2-oxo-4,5,7,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate.
| Compound Name | [(7S,9S,10Z,11aR)-7-acetyloxy-3-(hydroxymethyl)-10-methyl-6-methylidene-2-oxo-4,5,7,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate |
|---|---|
| PubChem CID | 163085906 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(7S,9S,10Z,11aR)-7-acetyloxy-3-(hydroxymethyl)-10-methyl-6-methylidene-2-oxo-4,5,7,8,9,11a-hexahydrocyclodeca[b]furan-9-yl] acetate |
| SMILES | C=C1CCC2=C(CO)C(=O)O[C@@H]2/C=C(/C)[C@@H](OC(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24O7/c1-10-5-6-14-15(9-20)19(23)26-18(14)7-11(2)17(25-13(4)22)8-16(10)24-12(3)21/h7,16-18,20H,1,5-6,8-9H2,2-4H3/b11-7-/t16-,17-,18+/m0/s1 |
| InChIKey | LCRDWOLDJDBCIK-XNSDRUKKSA-N |
| XLogP | 1.75 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|