C30H44O5 — CID 163085934
[(5R,7R,8R,9R,10R,13S,17S)-17-[(2S,3R)-2-ethoxyoxolan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 163085934) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is [(5R,7R,8R,9R,10R,13S,17S)-17-[(2S,3R)-2-ethoxyoxolan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(5R,7R,8R,9R,10R,13S,17S)-17-[(2S,3R)-2-ethoxyoxolan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 163085934 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [(5R,7R,8R,9R,10R,13S,17S)-17-[(2S,3R)-2-ethoxyoxolan-3-yl]-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CCO[C@H]1OCC[C@@H]1[C@@H]1CC=C2[C@@]3(C)[C@H](CC[C@]21C)[C@@]1(C)C=CC(=O)C(C)(C)[C@@H]1C[C@H]3OC(C)=O |
| InChI | InChI=1S/C30H44O5/c1-8-33-26-19(13-16-34-26)20-9-10-21-28(20,5)14-11-22-29(6)15-12-24(32)27(3,4)23(29)17-25(30(21,22)7)35-18(2)31/h10,12,15,19-20,22-23,25-26H,8-9,11,13-14,16-17H2,1-7H3/t19-,20+,22-,23+,25-,26+,28+,29-,30+/m1/s1 |
| InChIKey | OKZOQPOTCCCWIA-JJQPMSDKSA-N |
| XLogP | 5.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|